C30H43N3OSi — CID 102589572
[(E,2R)-2-azido-4-[(1S,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl]but-3-enoxy]-tert-butyl-diphenylsilane (PubChem CID 102589572) has the molecular formula C30H43N3OSi and a molecular weight of 489.78 g/mol. Its IUPAC name is [(E,2R)-2-azido-4-[(1S,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl]but-3-enoxy]-tert-butyl-diphenylsilane.
| Compound Name | [(E,2R)-2-azido-4-[(1S,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl]but-3-enoxy]-tert-butyl-diphenylsilane |
|---|---|
| PubChem CID | 102589572 |
| Molecular Formula | C30H43N3OSi |
| Molecular Weight | 489.78 g/mol |
| Exact Mass | 489.32 |
| IUPAC Name | [(E,2R)-2-azido-4-[(1S,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl]but-3-enoxy]-tert-butyl-diphenylsilane |
| SMILES | CC(C)[C@@H]1CC[C@@H](C)C[C@H]1/C=C/[C@H](CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)N=[N+]=[N-] |
| InChI | InChI=1S/C30H43N3OSi/c1-23(2)29-20-17-24(3)21-25(29)18-19-26(32-33-31)22-34-35(30(4,5)6,27-13-9-7-10-14-27)28-15-11-8-12-16-28/h7-16,18-19,23-26,29H,17,20-22H2,1-6H3/b19-18+/t24-,25-,26-,29+/m1/s1 |
| InChIKey | MUNOOICIFARKFR-OHITWQCFSA-N |
| XLogP | 7.51 |
| TPSA | 57.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.78 |
| LogP ≤ 5 | 7.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|