C15H22ClNO3S — CID 115928448
2-(5-methyl-2-propan-2-ylcyclohexyl)oxypyridine-3-sulfonyl chloride (PubChem CID 115928448) has the molecular formula C15H22ClNO3S and a molecular weight of 331.87 g/mol. Its IUPAC name is 2-(5-methyl-2-propan-2-ylcyclohexyl)oxypyridine-3-sulfonyl chloride.
| Compound Name | 2-(5-methyl-2-propan-2-ylcyclohexyl)oxypyridine-3-sulfonyl chloride |
|---|---|
| PubChem CID | 115928448 |
| Molecular Formula | C15H22ClNO3S |
| Molecular Weight | 331.87 g/mol |
| Exact Mass | 331.10 |
| IUPAC Name | 2-(5-methyl-2-propan-2-ylcyclohexyl)oxypyridine-3-sulfonyl chloride |
| SMILES | CC1CCC(C(C)C)C(Oc2ncccc2S(=O)(=O)Cl)C1 |
| InChI | InChI=1S/C15H22ClNO3S/c1-10(2)12-7-6-11(3)9-13(12)20-15-14(21(16,18)19)5-4-8-17-15/h4-5,8,10-13H,6-7,9H2,1-3H3 |
| InChIKey | SADQVFLZZSTSRO-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 56.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.87 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |