C15H21ClN2O3 — CID 43330212
6-chloro-2-(5-methyl-2-propan-2-ylcyclohexyl)oxy-3-nitropyridine (PubChem CID 43330212) has the molecular formula C15H21ClN2O3 and a molecular weight of 312.80 g/mol. Its IUPAC name is 6-chloro-2-(5-methyl-2-propan-2-ylcyclohexyl)oxy-3-nitropyridine.
| Compound Name | 6-chloro-2-(5-methyl-2-propan-2-ylcyclohexyl)oxy-3-nitropyridine |
|---|---|
| PubChem CID | 43330212 |
| Molecular Formula | C15H21ClN2O3 |
| Molecular Weight | 312.80 g/mol |
| Exact Mass | 312.12 |
| IUPAC Name | 6-chloro-2-(5-methyl-2-propan-2-ylcyclohexyl)oxy-3-nitropyridine |
| SMILES | CC1CCC(C(C)C)C(Oc2nc(Cl)ccc2[N+](=O)[O-])C1 |
| InChI | InChI=1S/C15H21ClN2O3/c1-9(2)11-5-4-10(3)8-13(11)21-15-12(18(19)20)6-7-14(16)17-15/h6-7,9-11,13H,4-5,8H2,1-3H3 |
| InChIKey | JHFHGJDEXGXURF-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 65.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.80 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|