C15H25N3O — CID 79827219
6-(5-methyl-2-propan-2-ylcyclohexyl)oxypyridine-2,3-diamine (PubChem CID 79827219) has the molecular formula C15H25N3O and a molecular weight of 263.38 g/mol. Its IUPAC name is 6-(5-methyl-2-propan-2-ylcyclohexyl)oxypyridine-2,3-diamine.
| Compound Name | 6-(5-methyl-2-propan-2-ylcyclohexyl)oxypyridine-2,3-diamine |
|---|---|
| PubChem CID | 79827219 |
| Molecular Formula | C15H25N3O |
| Molecular Weight | 263.38 g/mol |
| Exact Mass | 263.20 |
| IUPAC Name | 6-(5-methyl-2-propan-2-ylcyclohexyl)oxypyridine-2,3-diamine |
| SMILES | CC1CCC(C(C)C)C(Oc2ccc(N)c(N)n2)C1 |
| InChI | InChI=1S/C15H25N3O/c1-9(2)11-5-4-10(3)8-13(11)19-14-7-6-12(16)15(17)18-14/h6-7,9-11,13H,4-5,8,16H2,1-3H3,(H2,17,18) |
| InChIKey | NCCLYXGYZZZDJV-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 74.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.38 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |