C28H34NOP — CID 101367033
[6-[(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl]oxy-2-pyridinyl]methyl-diphenylphosphane (PubChem CID 101367033) has the molecular formula C28H34NOP and a molecular weight of 431.56 g/mol. Its IUPAC name is [6-[(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl]oxy-2-pyridinyl]methyl-diphenylphosphane.
| Compound Name | [6-[(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl]oxy-2-pyridinyl]methyl-diphenylphosphane |
|---|---|
| PubChem CID | 101367033 |
| Molecular Formula | C28H34NOP |
| Molecular Weight | 431.56 g/mol |
| Exact Mass | 431.24 |
| IUPAC Name | [6-[(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl]oxy-2-pyridinyl]methyl-diphenylphosphane |
| SMILES | CC(C)[C@@H]1CC[C@@H](C)C[C@H]1Oc1cccc(CP(c2ccccc2)c2ccccc2)n1 |
| InChI | InChI=1S/C28H34NOP/c1-21(2)26-18-17-22(3)19-27(26)30-28-16-10-11-23(29-28)20-31(24-12-6-4-7-13-24)25-14-8-5-9-15-25/h4-16,21-22,26-27H,17-20H2,1-3H3/t22-,26+,27-/m1/s1 |
| InChIKey | LANYOSDJPYXSGJ-VYCLJVNGSA-N |
| XLogP | 6.55 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.56 |
| LogP ≤ 5 | 6.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|