C18H19F2N — CID 43765027
3,5-difluoro-N-(2-phenylcyclohexyl)aniline (PubChem CID 43765027) has the molecular formula C18H19F2N and a molecular weight of 287.35 g/mol. Its IUPAC name is 3,5-difluoro-N-(2-phenylcyclohexyl)aniline.
| Compound Name | 3,5-difluoro-N-(2-phenylcyclohexyl)aniline |
|---|---|
| PubChem CID | 43765027 |
| Molecular Formula | C18H19F2N |
| Molecular Weight | 287.35 g/mol |
| Exact Mass | 287.15 |
| IUPAC Name | 3,5-difluoro-N-(2-phenylcyclohexyl)aniline |
| SMILES | Fc1cc(F)cc(NC2CCCCC2c2ccccc2)c1 |
| InChI | InChI=1S/C18H19F2N/c19-14-10-15(20)12-16(11-14)21-18-9-5-4-8-17(18)13-6-2-1-3-7-13/h1-3,6-7,10-12,17-18,21H,4-5,8-9H2 |
| InChIKey | VDZDBWQTWFJTPX-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.35 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |