C19H22BrN — CID 43758826
4-bromo-2-methyl-N-(2-phenylcyclohexyl)aniline (PubChem CID 43758826) has the molecular formula C19H22BrN and a molecular weight of 344.30 g/mol. Its IUPAC name is 4-bromo-2-methyl-N-(2-phenylcyclohexyl)aniline.
| Compound Name | 4-bromo-2-methyl-N-(2-phenylcyclohexyl)aniline |
|---|---|
| PubChem CID | 43758826 |
| Molecular Formula | C19H22BrN |
| Molecular Weight | 344.30 g/mol |
| Exact Mass | 343.09 |
| IUPAC Name | 4-bromo-2-methyl-N-(2-phenylcyclohexyl)aniline |
| SMILES | Cc1cc(Br)ccc1NC1CCCCC1c1ccccc1 |
| InChI | InChI=1S/C19H22BrN/c1-14-13-16(20)11-12-18(14)21-19-10-6-5-9-17(19)15-7-3-2-4-8-15/h2-4,7-8,11-13,17,19,21H,5-6,9-10H2,1H3 |
| InChIKey | DPGRPMMMYHWXRS-UHFFFAOYSA-N |
| XLogP | 5.90 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.30 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |