C15H19N — CID 43764534
N-(2-ethylphenyl)bicyclo[3.2.0]hept-3-en-6-amine (PubChem CID 43764534) has the molecular formula C15H19N and a molecular weight of 213.32 g/mol. Its IUPAC name is N-(2-ethylphenyl)bicyclo[3.2.0]hept-3-en-6-amine.
| Compound Name | N-(2-ethylphenyl)bicyclo[3.2.0]hept-3-en-6-amine |
|---|---|
| PubChem CID | 43764534 |
| Molecular Formula | C15H19N |
| Molecular Weight | 213.32 g/mol |
| Exact Mass | 213.15 |
| IUPAC Name | N-(2-ethylphenyl)bicyclo[3.2.0]hept-3-en-6-amine |
| SMILES | CCc1ccccc1NC1CC2CC=CC21 |
| InChI | InChI=1S/C15H19N/c1-2-11-6-3-4-9-14(11)16-15-10-12-7-5-8-13(12)15/h3-6,8-9,12-13,15-16H,2,7,10H2,1H3 |
| InChIKey | XETAJSBTTGQITK-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.32 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|