C17H22N2O — CID 43783528
3-(6-bicyclo[3.2.0]hept-3-enylamino)-N,N,4-trimethylbenzamide (PubChem CID 43783528) has the molecular formula C17H22N2O and a molecular weight of 270.38 g/mol. Its IUPAC name is 3-(6-bicyclo[3.2.0]hept-3-enylamino)-N,N,4-trimethylbenzamide.
| Compound Name | 3-(6-bicyclo[3.2.0]hept-3-enylamino)-N,N,4-trimethylbenzamide |
|---|---|
| PubChem CID | 43783528 |
| Molecular Formula | C17H22N2O |
| Molecular Weight | 270.38 g/mol |
| Exact Mass | 270.17 |
| IUPAC Name | 3-(6-bicyclo[3.2.0]hept-3-enylamino)-N,N,4-trimethylbenzamide |
| SMILES | Cc1ccc(C(=O)N(C)C)cc1NC1CC2CC=CC21 |
| InChI | InChI=1S/C17H22N2O/c1-11-7-8-13(17(20)19(2)3)10-15(11)18-16-9-12-5-4-6-14(12)16/h4,6-8,10,12,14,16,18H,5,9H2,1-3H3 |
| InChIKey | KFELOZWOZSPMLZ-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.38 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|