C15H18BrCl2NOS — CID 107789020
N-(4-bromo-2,3-dichlorophenyl)-1-oxa-9-thiaspiro[5.5]undecan-4-amine (PubChem CID 107789020) has the molecular formula C15H18BrCl2NOS and a molecular weight of 411.19 g/mol. Its IUPAC name is N-(4-bromo-2,3-dichlorophenyl)-1-oxa-9-thiaspiro[5.5]undecan-4-amine.
| Compound Name | N-(4-bromo-2,3-dichlorophenyl)-1-oxa-9-thiaspiro[5.5]undecan-4-amine |
|---|---|
| PubChem CID | 107789020 |
| Molecular Formula | C15H18BrCl2NOS |
| Molecular Weight | 411.19 g/mol |
| Exact Mass | 408.97 |
| IUPAC Name | N-(4-bromo-2,3-dichlorophenyl)-1-oxa-9-thiaspiro[5.5]undecan-4-amine |
| SMILES | Clc1c(Br)ccc(NC2CCOC3(CCSCC3)C2)c1Cl |
| InChI | InChI=1S/C15H18BrCl2NOS/c16-11-1-2-12(14(18)13(11)17)19-10-3-6-20-15(9-10)4-7-21-8-5-15/h1-2,10,19H,3-9H2 |
| InChIKey | SRARNWUQTCIYSY-UHFFFAOYSA-N |
| XLogP | 5.61 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.19 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|