C15H19Br2NOS — CID 79894936
N-(2,4-dibromophenyl)-1-oxa-9-thiaspiro[5.5]undecan-4-amine (PubChem CID 79894936) has the molecular formula C15H19Br2NOS and a molecular weight of 421.20 g/mol. Its IUPAC name is N-(2,4-dibromophenyl)-1-oxa-9-thiaspiro[5.5]undecan-4-amine.
| Compound Name | N-(2,4-dibromophenyl)-1-oxa-9-thiaspiro[5.5]undecan-4-amine |
|---|---|
| PubChem CID | 79894936 |
| Molecular Formula | C15H19Br2NOS |
| Molecular Weight | 421.20 g/mol |
| Exact Mass | 418.96 |
| IUPAC Name | N-(2,4-dibromophenyl)-1-oxa-9-thiaspiro[5.5]undecan-4-amine |
| SMILES | Brc1ccc(NC2CCOC3(CCSCC3)C2)c(Br)c1 |
| InChI | InChI=1S/C15H19Br2NOS/c16-11-1-2-14(13(17)9-11)18-12-3-6-19-15(10-12)4-7-20-8-5-15/h1-2,9,12,18H,3-8,10H2 |
| InChIKey | SKHBUZJIVUOZKP-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.20 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |