C15H18Cl3NOS — CID 79901635
N-(2,4,5-trichlorophenyl)-1-oxa-9-thiaspiro[5.5]undecan-4-amine (PubChem CID 79901635) has the molecular formula C15H18Cl3NOS and a molecular weight of 366.74 g/mol. Its IUPAC name is N-(2,4,5-trichlorophenyl)-1-oxa-9-thiaspiro[5.5]undecan-4-amine.
| Compound Name | N-(2,4,5-trichlorophenyl)-1-oxa-9-thiaspiro[5.5]undecan-4-amine |
|---|---|
| PubChem CID | 79901635 |
| Molecular Formula | C15H18Cl3NOS |
| Molecular Weight | 366.74 g/mol |
| Exact Mass | 365.02 |
| IUPAC Name | N-(2,4,5-trichlorophenyl)-1-oxa-9-thiaspiro[5.5]undecan-4-amine |
| SMILES | Clc1cc(Cl)c(NC2CCOC3(CCSCC3)C2)cc1Cl |
| InChI | InChI=1S/C15H18Cl3NOS/c16-11-7-13(18)14(8-12(11)17)19-10-1-4-20-15(9-10)2-5-21-6-3-15/h7-8,10,19H,1-6,9H2 |
| InChIKey | UCZBSSNPOZNTMT-UHFFFAOYSA-N |
| XLogP | 5.50 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.74 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|