C16H21Br2NO — CID 79895723
N-(2,5-dibromophenyl)-1-oxaspiro[5.5]undecan-4-amine (PubChem CID 79895723) has the molecular formula C16H21Br2NO and a molecular weight of 403.16 g/mol. Its IUPAC name is N-(2,5-dibromophenyl)-1-oxaspiro[5.5]undecan-4-amine.
| Compound Name | N-(2,5-dibromophenyl)-1-oxaspiro[5.5]undecan-4-amine |
|---|---|
| PubChem CID | 79895723 |
| Molecular Formula | C16H21Br2NO |
| Molecular Weight | 403.16 g/mol |
| Exact Mass | 401.00 |
| IUPAC Name | N-(2,5-dibromophenyl)-1-oxaspiro[5.5]undecan-4-amine |
| SMILES | Brc1ccc(Br)c(NC2CCOC3(CCCCC3)C2)c1 |
| InChI | InChI=1S/C16H21Br2NO/c17-12-4-5-14(18)15(10-12)19-13-6-9-20-16(11-13)7-2-1-3-8-16/h4-5,10,13,19H,1-3,6-9,11H2 |
| InChIKey | PQMUBPIZGCGHPP-UHFFFAOYSA-N |
| XLogP | 5.51 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.16 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |