C15H22BrNO2S — CID 81381403
N-[(1R)-1-(3-bromophenyl)ethyl]-3-methylsulfonylcyclohexan-1-amine (PubChem CID 81381403) has the molecular formula C15H22BrNO2S and a molecular weight of 360.32 g/mol. Its IUPAC name is N-[(1R)-1-(3-bromophenyl)ethyl]-3-methylsulfonylcyclohexan-1-amine.
| Compound Name | N-[(1R)-1-(3-bromophenyl)ethyl]-3-methylsulfonylcyclohexan-1-amine |
|---|---|
| PubChem CID | 81381403 |
| Molecular Formula | C15H22BrNO2S |
| Molecular Weight | 360.32 g/mol |
| Exact Mass | 359.06 |
| IUPAC Name | N-[(1R)-1-(3-bromophenyl)ethyl]-3-methylsulfonylcyclohexan-1-amine |
| SMILES | C[C@@H](NC1CCCC(S(C)(=O)=O)C1)c1cccc(Br)c1 |
| InChI | InChI=1S/C15H22BrNO2S/c1-11(12-5-3-6-13(16)9-12)17-14-7-4-8-15(10-14)20(2,18)19/h3,5-6,9,11,14-15,17H,4,7-8,10H2,1-2H3/t11-,14?,15?/m1/s1 |
| InChIKey | FJYKDXQDRYENHW-VCANKDNSSA-N |
| XLogP | 3.46 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.32 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |