C13H21NO3S — CID 81399415
N-[(1R)-1-(furan-2-yl)ethyl]-3-methylsulfonylcyclohexan-1-amine (PubChem CID 81399415) has the molecular formula C13H21NO3S and a molecular weight of 271.38 g/mol. Its IUPAC name is N-[(1R)-1-(furan-2-yl)ethyl]-3-methylsulfonylcyclohexan-1-amine.
| Compound Name | N-[(1R)-1-(furan-2-yl)ethyl]-3-methylsulfonylcyclohexan-1-amine |
|---|---|
| PubChem CID | 81399415 |
| Molecular Formula | C13H21NO3S |
| Molecular Weight | 271.38 g/mol |
| Exact Mass | 271.12 |
| IUPAC Name | N-[(1R)-1-(furan-2-yl)ethyl]-3-methylsulfonylcyclohexan-1-amine |
| SMILES | C[C@@H](NC1CCCC(S(C)(=O)=O)C1)c1ccco1 |
| InChI | InChI=1S/C13H21NO3S/c1-10(13-7-4-8-17-13)14-11-5-3-6-12(9-11)18(2,15)16/h4,7-8,10-12,14H,3,5-6,9H2,1-2H3/t10-,11?,12?/m1/s1 |
| InChIKey | BQGPCWAKUAOLGZ-VOMCLLRMSA-N |
| XLogP | 2.29 |
| TPSA | 59.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.38 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |