C11H12ClNO2S — CID 43736227
2-chloro-5-(thiolan-3-ylamino)benzoic acid (PubChem CID 43736227) has the molecular formula C11H12ClNO2S and a molecular weight of 257.74 g/mol. Its IUPAC name is 2-chloro-5-(thiolan-3-ylamino)benzoic acid.
| Compound Name | 2-chloro-5-(thiolan-3-ylamino)benzoic acid |
|---|---|
| PubChem CID | 43736227 |
| Molecular Formula | C11H12ClNO2S |
| Molecular Weight | 257.74 g/mol |
| Exact Mass | 257.03 |
| IUPAC Name | 2-chloro-5-(thiolan-3-ylamino)benzoic acid |
| SMILES | O=C(O)c1cc(NC2CCSC2)ccc1Cl |
| InChI | InChI=1S/C11H12ClNO2S/c12-10-2-1-7(5-9(10)11(14)15)13-8-3-4-16-6-8/h1-2,5,8,13H,3-4,6H2,(H,14,15) |
| InChIKey | SMFYYFVXDVHLDK-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.74 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |