C17H22ClNO2 — CID 114817395
2-chloro-5-(spiro[4.5]decan-8-ylamino)benzoic acid (PubChem CID 114817395) has the molecular formula C17H22ClNO2 and a molecular weight of 307.82 g/mol. Its IUPAC name is 2-chloro-5-(spiro[4.5]decan-8-ylamino)benzoic acid.
| Compound Name | 2-chloro-5-(spiro[4.5]decan-8-ylamino)benzoic acid |
|---|---|
| PubChem CID | 114817395 |
| Molecular Formula | C17H22ClNO2 |
| Molecular Weight | 307.82 g/mol |
| Exact Mass | 307.13 |
| IUPAC Name | 2-chloro-5-(spiro[4.5]decan-8-ylamino)benzoic acid |
| SMILES | O=C(O)c1cc(NC2CCC3(CCCC3)CC2)ccc1Cl |
| InChI | InChI=1S/C17H22ClNO2/c18-15-4-3-13(11-14(15)16(20)21)19-12-5-9-17(10-6-12)7-1-2-8-17/h3-4,11-12,19H,1-2,5-10H2,(H,20,21) |
| InChIKey | QDMOKLQPDDETON-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.82 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |