C15H18ClNO4 — CID 43736297
2-chloro-5-(1,4-dioxaspiro[4.5]decan-8-ylamino)benzoic acid (PubChem CID 43736297) has the molecular formula C15H18ClNO4 and a molecular weight of 311.76 g/mol. Its IUPAC name is 2-chloro-5-(1,4-dioxaspiro[4.5]decan-8-ylamino)benzoic acid.
| Compound Name | 2-chloro-5-(1,4-dioxaspiro[4.5]decan-8-ylamino)benzoic acid |
|---|---|
| PubChem CID | 43736297 |
| Molecular Formula | C15H18ClNO4 |
| Molecular Weight | 311.76 g/mol |
| Exact Mass | 311.09 |
| IUPAC Name | 2-chloro-5-(1,4-dioxaspiro[4.5]decan-8-ylamino)benzoic acid |
| SMILES | O=C(O)c1cc(NC2CCC3(CC2)OCCO3)ccc1Cl |
| InChI | InChI=1S/C15H18ClNO4/c16-13-2-1-11(9-12(13)14(18)19)17-10-3-5-15(6-4-10)20-7-8-21-15/h1-2,9-10,17H,3-8H2,(H,18,19) |
| InChIKey | HYYKGMJZGRAIRR-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.76 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |