C11H12BrNO2S — CID 103064834
5-bromo-2-(thiolan-3-ylamino)benzoic acid (PubChem CID 103064834) has the molecular formula C11H12BrNO2S and a molecular weight of 302.19 g/mol. Its IUPAC name is 5-bromo-2-(thiolan-3-ylamino)benzoic acid.
| Compound Name | 5-bromo-2-(thiolan-3-ylamino)benzoic acid |
|---|---|
| PubChem CID | 103064834 |
| Molecular Formula | C11H12BrNO2S |
| Molecular Weight | 302.19 g/mol |
| Exact Mass | 300.98 |
| IUPAC Name | 5-bromo-2-(thiolan-3-ylamino)benzoic acid |
| SMILES | O=C(O)c1cc(Br)ccc1NC1CCSC1 |
| InChI | InChI=1S/C11H12BrNO2S/c12-7-1-2-10(9(5-7)11(14)15)13-8-3-4-16-6-8/h1-2,5,8,13H,3-4,6H2,(H,14,15) |
| InChIKey | PAFFXFIOTDOPGG-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.19 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |