C9H11ClN2S — CID 103705049
5-chloro-N-(thiolan-3-yl)pyridin-2-amine (PubChem CID 103705049) has the molecular formula C9H11ClN2S and a molecular weight of 214.72 g/mol. Its IUPAC name is 5-chloro-N-(thiolan-3-yl)pyridin-2-amine.
| Compound Name | 5-chloro-N-(thiolan-3-yl)pyridin-2-amine |
|---|---|
| PubChem CID | 103705049 |
| Molecular Formula | C9H11ClN2S |
| Molecular Weight | 214.72 g/mol |
| Exact Mass | 214.03 |
| IUPAC Name | 5-chloro-N-(thiolan-3-yl)pyridin-2-amine |
| SMILES | Clc1ccc(NC2CCSC2)nc1 |
| InChI | InChI=1S/C9H11ClN2S/c10-7-1-2-9(11-5-7)12-8-3-4-13-6-8/h1-2,5,8H,3-4,6H2,(H,11,12) |
| InChIKey | YFQHRPXHYVSJQD-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.72 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |