C15H24N2S — CID 62873258
4-N,4-N-diethyl-1-N-(thian-3-yl)benzene-1,4-diamine (PubChem CID 62873258) has the molecular formula C15H24N2S and a molecular weight of 264.44 g/mol. Its IUPAC name is 4-N,4-N-diethyl-1-N-(thian-3-yl)benzene-1,4-diamine.
| Compound Name | 4-N,4-N-diethyl-1-N-(thian-3-yl)benzene-1,4-diamine |
|---|---|
| PubChem CID | 62873258 |
| Molecular Formula | C15H24N2S |
| Molecular Weight | 264.44 g/mol |
| Exact Mass | 264.17 |
| IUPAC Name | 4-N,4-N-diethyl-1-N-(thian-3-yl)benzene-1,4-diamine |
| SMILES | CCN(CC)c1ccc(NC2CCCSC2)cc1 |
| InChI | InChI=1S/C15H24N2S/c1-3-17(4-2)15-9-7-13(8-10-15)16-14-6-5-11-18-12-14/h7-10,14,16H,3-6,11-12H2,1-2H3 |
| InChIKey | CYDXKNBSFMQBMD-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.44 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|