C16H27N3 — CID 79725282
1-N-(4-aminocyclohexyl)-4-N,4-N-diethylbenzene-1,4-diamine (PubChem CID 79725282) has the molecular formula C16H27N3 and a molecular weight of 261.41 g/mol. Its IUPAC name is 1-N-(4-aminocyclohexyl)-4-N,4-N-diethylbenzene-1,4-diamine.
| Compound Name | 1-N-(4-aminocyclohexyl)-4-N,4-N-diethylbenzene-1,4-diamine |
|---|---|
| PubChem CID | 79725282 |
| Molecular Formula | C16H27N3 |
| Molecular Weight | 261.41 g/mol |
| Exact Mass | 261.22 |
| IUPAC Name | 1-N-(4-aminocyclohexyl)-4-N,4-N-diethylbenzene-1,4-diamine |
| SMILES | CCN(CC)c1ccc(NC2CCC(N)CC2)cc1 |
| InChI | InChI=1S/C16H27N3/c1-3-19(4-2)16-11-9-15(10-12-16)18-14-7-5-13(17)6-8-14/h9-14,18H,3-8,17H2,1-2H3 |
| InChIKey | NUQGCMQQHAFTRD-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 41.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.41 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|