C16H24N2 — CID 112739993
1-N-(2-bicyclo[3.1.0]hexanyl)-4-N,4-N-diethylbenzene-1,4-diamine (PubChem CID 112739993) has the molecular formula C16H24N2 and a molecular weight of 244.38 g/mol. Its IUPAC name is 1-N-(2-bicyclo[3.1.0]hexanyl)-4-N,4-N-diethylbenzene-1,4-diamine.
| Compound Name | 1-N-(2-bicyclo[3.1.0]hexanyl)-4-N,4-N-diethylbenzene-1,4-diamine |
|---|---|
| PubChem CID | 112739993 |
| Molecular Formula | C16H24N2 |
| Molecular Weight | 244.38 g/mol |
| Exact Mass | 244.19 |
| IUPAC Name | 1-N-(2-bicyclo[3.1.0]hexanyl)-4-N,4-N-diethylbenzene-1,4-diamine |
| SMILES | CCN(CC)c1ccc(NC2CCC3CC32)cc1 |
| InChI | InChI=1S/C16H24N2/c1-3-18(4-2)14-8-6-13(7-9-14)17-16-10-5-12-11-15(12)16/h6-9,12,15-17H,3-5,10-11H2,1-2H3 |
| InChIKey | SOKAZWHPGCIIRF-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.38 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|