C18H23N3 — CID 102772921
1-N-(6,7-dihydro-5H-cyclopenta[b]pyridin-7-yl)-4-N,4-N-diethylbenzene-1,4-diamine (PubChem CID 102772921) has the molecular formula C18H23N3 and a molecular weight of 281.40 g/mol. Its IUPAC name is 1-N-(6,7-dihydro-5H-cyclopenta[b]pyridin-7-yl)-4-N,4-N-diethylbenzene-1,4-diamine.
| Compound Name | 1-N-(6,7-dihydro-5H-cyclopenta[b]pyridin-7-yl)-4-N,4-N-diethylbenzene-1,4-diamine |
|---|---|
| PubChem CID | 102772921 |
| Molecular Formula | C18H23N3 |
| Molecular Weight | 281.40 g/mol |
| Exact Mass | 281.19 |
| IUPAC Name | 1-N-(6,7-dihydro-5H-cyclopenta[b]pyridin-7-yl)-4-N,4-N-diethylbenzene-1,4-diamine |
| SMILES | CCN(CC)c1ccc(NC2CCc3cccnc32)cc1 |
| InChI | InChI=1S/C18H23N3/c1-3-21(4-2)16-10-8-15(9-11-16)20-17-12-7-14-6-5-13-19-18(14)17/h5-6,8-11,13,17,20H,3-4,7,12H2,1-2H3 |
| InChIKey | SJPKAJYGEMIRFS-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 28.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.40 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|