C19H24N2 — CID 102772729
N-(4-pentylphenyl)-6,7-dihydro-5H-cyclopenta[b]pyridin-7-amine (PubChem CID 102772729) has the molecular formula C19H24N2 and a molecular weight of 280.42 g/mol. Its IUPAC name is N-(4-pentylphenyl)-6,7-dihydro-5H-cyclopenta[b]pyridin-7-amine.
| Compound Name | N-(4-pentylphenyl)-6,7-dihydro-5H-cyclopenta[b]pyridin-7-amine |
|---|---|
| PubChem CID | 102772729 |
| Molecular Formula | C19H24N2 |
| Molecular Weight | 280.42 g/mol |
| Exact Mass | 280.19 |
| IUPAC Name | N-(4-pentylphenyl)-6,7-dihydro-5H-cyclopenta[b]pyridin-7-amine |
| SMILES | CCCCCc1ccc(NC2CCc3cccnc32)cc1 |
| InChI | InChI=1S/C19H24N2/c1-2-3-4-6-15-8-11-17(12-9-15)21-18-13-10-16-7-5-14-20-19(16)18/h5,7-9,11-12,14,18,21H,2-4,6,10,13H2,1H3 |
| InChIKey | APRAIUUYLLJPLI-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.42 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|