C16H26N2 — CID 114138079
N-octan-4-yl-6,7-dihydro-5H-cyclopenta[b]pyridin-7-amine (PubChem CID 114138079) has the molecular formula C16H26N2 and a molecular weight of 246.40 g/mol. Its IUPAC name is N-octan-4-yl-6,7-dihydro-5H-cyclopenta[b]pyridin-7-amine.
| Compound Name | N-octan-4-yl-6,7-dihydro-5H-cyclopenta[b]pyridin-7-amine |
|---|---|
| PubChem CID | 114138079 |
| Molecular Formula | C16H26N2 |
| Molecular Weight | 246.40 g/mol |
| Exact Mass | 246.21 |
| IUPAC Name | N-octan-4-yl-6,7-dihydro-5H-cyclopenta[b]pyridin-7-amine |
| SMILES | CCCCC(CCC)NC1CCc2cccnc21 |
| InChI | InChI=1S/C16H26N2/c1-3-5-9-14(7-4-2)18-15-11-10-13-8-6-12-17-16(13)15/h6,8,12,14-15,18H,3-5,7,9-11H2,1-2H3 |
| InChIKey | IIGLWXPUIYBIHU-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.40 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |