C18H29N3 — CID 115871482
1-N-(1-cyclopropyl-5-methylpyrrolidin-3-yl)-4-N,4-N-diethylbenzene-1,4-diamine (PubChem CID 115871482) has the molecular formula C18H29N3 and a molecular weight of 287.45 g/mol. Its IUPAC name is 1-N-(1-cyclopropyl-5-methylpyrrolidin-3-yl)-4-N,4-N-diethylbenzene-1,4-diamine.
| Compound Name | 1-N-(1-cyclopropyl-5-methylpyrrolidin-3-yl)-4-N,4-N-diethylbenzene-1,4-diamine |
|---|---|
| PubChem CID | 115871482 |
| Molecular Formula | C18H29N3 |
| Molecular Weight | 287.45 g/mol |
| Exact Mass | 287.24 |
| IUPAC Name | 1-N-(1-cyclopropyl-5-methylpyrrolidin-3-yl)-4-N,4-N-diethylbenzene-1,4-diamine |
| SMILES | CCN(CC)c1ccc(NC2CC(C)N(C3CC3)C2)cc1 |
| InChI | InChI=1S/C18H29N3/c1-4-20(5-2)17-8-6-15(7-9-17)19-16-12-14(3)21(13-16)18-10-11-18/h6-9,14,16,18-19H,4-5,10-13H2,1-3H3 |
| InChIKey | YSNNELPSIHATSS-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 18.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.45 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|