C13H15F2NO3 — CID 112633175
3-[(2,2-difluoro-1,3-benzodioxol-5-yl)amino]-2,2-dimethylcyclobutan-1-ol (PubChem CID 112633175) has the molecular formula C13H15F2NO3 and a molecular weight of 271.26 g/mol. Its IUPAC name is 3-[(2,2-difluoro-1,3-benzodioxol-5-yl)amino]-2,2-dimethylcyclobutan-1-ol.
| Compound Name | 3-[(2,2-difluoro-1,3-benzodioxol-5-yl)amino]-2,2-dimethylcyclobutan-1-ol |
|---|---|
| PubChem CID | 112633175 |
| Molecular Formula | C13H15F2NO3 |
| Molecular Weight | 271.26 g/mol |
| Exact Mass | 271.10 |
| IUPAC Name | 3-[(2,2-difluoro-1,3-benzodioxol-5-yl)amino]-2,2-dimethylcyclobutan-1-ol |
| SMILES | CC1(C)C(O)CC1Nc1ccc2c(c1)OC(F)(F)O2 |
| InChI | InChI=1S/C13H15F2NO3/c1-12(2)10(6-11(12)17)16-7-3-4-8-9(5-7)19-13(14,15)18-8/h3-5,10-11,16-17H,6H2,1-2H3 |
| InChIKey | FLVVZFRGWHSOKN-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 50.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.26 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|