C14H19NO3 — CID 43608361
N-(oxan-4-yl)-3,4-dihydro-2H-1,5-benzodioxepin-7-amine (PubChem CID 43608361) has the molecular formula C14H19NO3 and a molecular weight of 249.31 g/mol. Its IUPAC name is N-(oxan-4-yl)-3,4-dihydro-2H-1,5-benzodioxepin-7-amine.
| Compound Name | N-(oxan-4-yl)-3,4-dihydro-2H-1,5-benzodioxepin-7-amine |
|---|---|
| PubChem CID | 43608361 |
| Molecular Formula | C14H19NO3 |
| Molecular Weight | 249.31 g/mol |
| Exact Mass | 249.14 |
| IUPAC Name | N-(oxan-4-yl)-3,4-dihydro-2H-1,5-benzodioxepin-7-amine |
| SMILES | c1cc2c(cc1NC1CCOCC1)OCCCO2 |
| InChI | InChI=1S/C14H19NO3/c1-6-17-13-3-2-12(10-14(13)18-7-1)15-11-4-8-16-9-5-11/h2-3,10-11,15H,1,4-9H2 |
| InChIKey | YDLQPCWXAWUOGY-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 39.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.31 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|