C13H17NO3 — CID 63332139
N-(oxolan-3-yl)-3,4-dihydro-2H-1,5-benzodioxepin-7-amine (PubChem CID 63332139) has the molecular formula C13H17NO3 and a molecular weight of 235.28 g/mol. Its IUPAC name is N-(oxolan-3-yl)-3,4-dihydro-2H-1,5-benzodioxepin-7-amine.
| Compound Name | N-(oxolan-3-yl)-3,4-dihydro-2H-1,5-benzodioxepin-7-amine |
|---|---|
| PubChem CID | 63332139 |
| Molecular Formula | C13H17NO3 |
| Molecular Weight | 235.28 g/mol |
| Exact Mass | 235.12 |
| IUPAC Name | N-(oxolan-3-yl)-3,4-dihydro-2H-1,5-benzodioxepin-7-amine |
| SMILES | c1cc2c(cc1NC1CCOC1)OCCCO2 |
| InChI | InChI=1S/C13H17NO3/c1-5-16-12-3-2-10(8-13(12)17-6-1)14-11-4-7-15-9-11/h2-3,8,11,14H,1,4-7,9H2 |
| InChIKey | ZEUQMOTVOBOPPI-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 39.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.28 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|