C12H11N3O — CID 107788481
4-(oxolan-3-ylamino)benzene-1,2-dicarbonitrile (PubChem CID 107788481) has the molecular formula C12H11N3O and a molecular weight of 213.24 g/mol. Its IUPAC name is 4-(oxolan-3-ylamino)benzene-1,2-dicarbonitrile.
| Compound Name | 4-(oxolan-3-ylamino)benzene-1,2-dicarbonitrile |
|---|---|
| PubChem CID | 107788481 |
| Molecular Formula | C12H11N3O |
| Molecular Weight | 213.24 g/mol |
| Exact Mass | 213.09 |
| IUPAC Name | 4-(oxolan-3-ylamino)benzene-1,2-dicarbonitrile |
| SMILES | N#Cc1ccc(NC2CCOC2)cc1C#N |
| InChI | InChI=1S/C12H11N3O/c13-6-9-1-2-11(5-10(9)7-14)15-12-3-4-16-8-12/h1-2,5,12,15H,3-4,8H2 |
| InChIKey | GVBDDKPWRROSRA-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 68.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.24 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |