C10H9FO2 — CID 115015562
7-fluoro-4,5-dihydro-3H-1-benzoxepin-2-one (PubChem CID 115015562) has the molecular formula C10H9FO2 and a molecular weight of 180.18 g/mol. Its IUPAC name is 7-fluoro-4,5-dihydro-3H-1-benzoxepin-2-one.
| Compound Name | 7-fluoro-4,5-dihydro-3H-1-benzoxepin-2-one |
|---|---|
| PubChem CID | 115015562 |
| Molecular Formula | C10H9FO2 |
| Molecular Weight | 180.18 g/mol |
| Exact Mass | 180.06 |
| IUPAC Name | 7-fluoro-4,5-dihydro-3H-1-benzoxepin-2-one |
| SMILES | O=C1CCCc2cc(F)ccc2O1 |
| InChI | InChI=1S/C10H9FO2/c11-8-4-5-9-7(6-8)2-1-3-10(12)13-9/h4-6H,1-3H2 |
| InChIKey | TWFUBAGAHWJWNZ-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.18 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|