C11H18N2O3 — CID 171872275
1-(6-amino-2,4-dimethyl-3-pyridinyl)butane-1,2,4-triol (PubChem CID 171872275) has the molecular formula C11H18N2O3 and a molecular weight of 226.28 g/mol. Its IUPAC name is 1-(6-amino-2,4-dimethyl-3-pyridinyl)butane-1,2,4-triol.
| Compound Name | 1-(6-amino-2,4-dimethyl-3-pyridinyl)butane-1,2,4-triol |
|---|---|
| PubChem CID | 171872275 |
| Molecular Formula | C11H18N2O3 |
| Molecular Weight | 226.28 g/mol |
| Exact Mass | 226.13 |
| IUPAC Name | 1-(6-amino-2,4-dimethyl-3-pyridinyl)butane-1,2,4-triol |
| SMILES | Cc1cc(N)nc(C)c1C(O)C(O)CCO |
| InChI | InChI=1S/C11H18N2O3/c1-6-5-9(12)13-7(2)10(6)11(16)8(15)3-4-14/h5,8,11,14-16H,3-4H2,1-2H3,(H2,12,13) |
| InChIKey | CQJTYPXQHFXYGK-UHFFFAOYSA-N |
| XLogP | 0.06 |
| TPSA | 99.60 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.28 |
| LogP ≤ 5 | 0.06 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |