C12H15N3O3S — CID 171876062
S-[3,4-dihydroxy-4-(1H-pyrazolo[4,5-b]pyridin-6-yl)butyl] ethanethioate (PubChem CID 171876062) has the molecular formula C12H15N3O3S and a molecular weight of 281.34 g/mol. Its IUPAC name is S-[3,4-dihydroxy-4-(1H-pyrazolo[4,5-b]pyridin-6-yl)butyl] ethanethioate.
| Compound Name | S-[3,4-dihydroxy-4-(1H-pyrazolo[4,5-b]pyridin-6-yl)butyl] ethanethioate |
|---|---|
| PubChem CID | 171876062 |
| Molecular Formula | C12H15N3O3S |
| Molecular Weight | 281.34 g/mol |
| Exact Mass | 281.08 |
| IUPAC Name | S-[3,4-dihydroxy-4-(1H-pyrazolo[4,5-b]pyridin-6-yl)butyl] ethanethioate |
| SMILES | CC(=O)SCCC(O)C(O)c1cnc2cn[nH]c2c1 |
| InChI | InChI=1S/C12H15N3O3S/c1-7(16)19-3-2-11(17)12(18)8-4-9-10(13-5-8)6-14-15-9/h4-6,11-12,17-18H,2-3H2,1H3,(H,14,15) |
| InChIKey | VVCUMBOMKMRINI-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 99.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.34 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|