C19H33BN2O3 — CID 174018954
N-methyl-3-[[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3-pyridinyl]oxymethyl]hexan-1-amine (PubChem CID 174018954) has the molecular formula C19H33BN2O3 and a molecular weight of 348.30 g/mol. Its IUPAC name is N-methyl-3-[[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3-pyridinyl]oxymethyl]hexan-1-amine.
| Compound Name | N-methyl-3-[[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3-pyridinyl]oxymethyl]hexan-1-amine |
|---|---|
| PubChem CID | 174018954 |
| Molecular Formula | C19H33BN2O3 |
| Molecular Weight | 348.30 g/mol |
| Exact Mass | 348.26 |
| IUPAC Name | N-methyl-3-[[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3-pyridinyl]oxymethyl]hexan-1-amine |
| SMILES | CCCC(CCNC)COc1cncc(B2OC(C)(C)C(C)(C)O2)c1 |
| InChI | InChI=1S/C19H33BN2O3/c1-7-8-15(9-10-21-6)14-23-17-11-16(12-22-13-17)20-24-18(2,3)19(4,5)25-20/h11-13,15,21H,7-10,14H2,1-6H3 |
| InChIKey | ZEYIVFVJBBDJCJ-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 52.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.30 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|