C19H31BN2O6S — CID 123932065
hexyl 2-[[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3-pyridinyl]sulfonylamino]acetate (PubChem CID 123932065) has the molecular formula C19H31BN2O6S and a molecular weight of 426.34 g/mol. Its IUPAC name is hexyl 2-[[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3-pyridinyl]sulfonylamino]acetate.
| Compound Name | hexyl 2-[[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3-pyridinyl]sulfonylamino]acetate |
|---|---|
| PubChem CID | 123932065 |
| Molecular Formula | C19H31BN2O6S |
| Molecular Weight | 426.34 g/mol |
| Exact Mass | 426.20 |
| IUPAC Name | hexyl 2-[[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3-pyridinyl]sulfonylamino]acetate |
| SMILES | CCCCCCOC(=O)CNS(=O)(=O)c1cncc(B2OC(C)(C)C(C)(C)O2)c1 |
| InChI | InChI=1S/C19H31BN2O6S/c1-6-7-8-9-10-26-17(23)14-22-29(24,25)16-11-15(12-21-13-16)20-27-18(2,3)19(4,5)28-20/h11-13,22H,6-10,14H2,1-5H3 |
| InChIKey | RGVYIUFBWDCNOM-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 103.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.34 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|