C15H22BN2O6S- — CID 90425188
3-[(2-ethoxy-2-oxoethyl)-sulfinatoamino]-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine (PubChem CID 90425188) has the molecular formula C15H22BN2O6S- and a molecular weight of 369.23 g/mol. Its IUPAC name is 3-[(2-ethoxy-2-oxoethyl)-sulfinatoamino]-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine.
| Compound Name | 3-[(2-ethoxy-2-oxoethyl)-sulfinatoamino]-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine |
|---|---|
| PubChem CID | 90425188 |
| Molecular Formula | C15H22BN2O6S- |
| Molecular Weight | 369.23 g/mol |
| Exact Mass | 369.13 |
| IUPAC Name | 3-[(2-ethoxy-2-oxoethyl)-sulfinatoamino]-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine |
| SMILES | CCOC(=O)CN(c1cncc(B2OC(C)(C)C(C)(C)O2)c1)S(=O)[O-] |
| InChI | InChI=1S/C15H23BN2O6S/c1-6-22-13(19)10-18(25(20)21)12-7-11(8-17-9-12)16-23-14(2,3)15(4,5)24-16/h7-9H,6,10H2,1-5H3,(H,20,21)/p-1 |
| InChIKey | BVTTYHQSUIMMNN-UHFFFAOYSA-M |
| XLogP | 0.54 |
| TPSA | 101.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.23 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|