C16H25BN2O4 — CID 90296726
ethyl 2-[1-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazol-1-yl]cyclopropyl]acetate (PubChem CID 90296726) has the molecular formula C16H25BN2O4 and a molecular weight of 320.20 g/mol. Its IUPAC name is ethyl 2-[1-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazol-1-yl]cyclopropyl]acetate.
| Compound Name | ethyl 2-[1-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazol-1-yl]cyclopropyl]acetate |
|---|---|
| PubChem CID | 90296726 |
| Molecular Formula | C16H25BN2O4 |
| Molecular Weight | 320.20 g/mol |
| Exact Mass | 320.19 |
| IUPAC Name | ethyl 2-[1-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazol-1-yl]cyclopropyl]acetate |
| SMILES | CCOC(=O)CC1(n2cc(B3OC(C)(C)C(C)(C)O3)cn2)CC1 |
| InChI | InChI=1S/C16H25BN2O4/c1-6-21-13(20)9-16(7-8-16)19-11-12(10-18-19)17-22-14(2,3)15(4,5)23-17/h10-11H,6-9H2,1-5H3 |
| InChIKey | ACRVQWPABFEXIH-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 62.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.20 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|