C14H20BN3O3 — CID 90296660
2-[3-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazol-1-yl]oxetan-3-yl]acetonitrile (PubChem CID 90296660) has the molecular formula C14H20BN3O3 and a molecular weight of 289.14 g/mol. Its IUPAC name is 2-[3-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazol-1-yl]oxetan-3-yl]acetonitrile.
| Compound Name | 2-[3-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazol-1-yl]oxetan-3-yl]acetonitrile |
|---|---|
| PubChem CID | 90296660 |
| Molecular Formula | C14H20BN3O3 |
| Molecular Weight | 289.14 g/mol |
| Exact Mass | 289.16 |
| IUPAC Name | 2-[3-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazol-1-yl]oxetan-3-yl]acetonitrile |
| SMILES | CC1(C)OB(c2cnn(C3(CC#N)COC3)c2)OC1(C)C |
| InChI | InChI=1S/C14H20BN3O3/c1-12(2)13(3,4)21-15(20-12)11-7-17-18(8-11)14(5-6-16)9-19-10-14/h7-8H,5,9-10H2,1-4H3 |
| InChIKey | UOIGSEOYEFZRJX-UHFFFAOYSA-N |
| XLogP | 0.82 |
| TPSA | 69.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.14 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|