C14H22BN3O2 — CID 156727647
1-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazol-1-yl]-3-azabicyclo[3.1.0]hexane (PubChem CID 156727647) has the molecular formula C14H22BN3O2 and a molecular weight of 275.16 g/mol. Its IUPAC name is 1-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazol-1-yl]-3-azabicyclo[3.1.0]hexane.
| Compound Name | 1-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazol-1-yl]-3-azabicyclo[3.1.0]hexane |
|---|---|
| PubChem CID | 156727647 |
| Molecular Formula | C14H22BN3O2 |
| Molecular Weight | 275.16 g/mol |
| Exact Mass | 275.18 |
| IUPAC Name | 1-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazol-1-yl]-3-azabicyclo[3.1.0]hexane |
| SMILES | CC1(C)OB(c2cnn(C34CNCC3C4)c2)OC1(C)C |
| InChI | InChI=1S/C14H22BN3O2/c1-12(2)13(3,4)20-15(19-12)11-7-17-18(8-11)14-5-10(14)6-16-9-14/h7-8,10,16H,5-6,9H2,1-4H3 |
| InChIKey | SRRCCJMXGVJMNV-UHFFFAOYSA-N |
| XLogP | 0.50 |
| TPSA | 48.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.16 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|