C16H25BN4O2 — CID 153263750
2-[cyclopentyl-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazol-1-yl]amino]acetonitrile (PubChem CID 153263750) has the molecular formula C16H25BN4O2 and a molecular weight of 316.21 g/mol. Its IUPAC name is 2-[cyclopentyl-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazol-1-yl]amino]acetonitrile.
| Compound Name | 2-[cyclopentyl-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazol-1-yl]amino]acetonitrile |
|---|---|
| PubChem CID | 153263750 |
| Molecular Formula | C16H25BN4O2 |
| Molecular Weight | 316.21 g/mol |
| Exact Mass | 316.21 |
| IUPAC Name | 2-[cyclopentyl-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazol-1-yl]amino]acetonitrile |
| SMILES | CC1(C)OB(c2cnn(N(CC#N)C3CCCC3)c2)OC1(C)C |
| InChI | InChI=1S/C16H25BN4O2/c1-15(2)16(3,4)23-17(22-15)13-11-19-21(12-13)20(10-9-18)14-7-5-6-8-14/h11-12,14H,5-8,10H2,1-4H3 |
| InChIKey | WVTHOQFDARPGGZ-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 63.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.21 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|