C24H43B3N2O8 — CID 123639329
ethyl 4-[methoxy-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)boranyl]oxy-2-methyl-2-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazol-1-yl]pentanoate (PubChem CID 123639329) has the molecular formula C24H43B3N2O8 and a molecular weight of 520.05 g/mol. Its IUPAC name is ethyl 4-[methoxy-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)boranyl]oxy-2-methyl-2-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazol-1-yl]pentanoate.
| Compound Name | ethyl 4-[methoxy-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)boranyl]oxy-2-methyl-2-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazol-1-yl]pentanoate |
|---|---|
| PubChem CID | 123639329 |
| Molecular Formula | C24H43B3N2O8 |
| Molecular Weight | 520.05 g/mol |
| Exact Mass | 520.33 |
| IUPAC Name | ethyl 4-[methoxy-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)boranyl]oxy-2-methyl-2-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazol-1-yl]pentanoate |
| SMILES | CCOC(=O)C(C)(CC(C)OB(OC)B1OC(C)(C)C(C)(C)O1)n1cc(B2OC(C)(C)C(C)(C)O2)cn1 |
| InChI | InChI=1S/C24H43B3N2O8/c1-13-32-19(30)24(11,29-16-18(15-28-29)25-34-20(3,4)21(5,6)35-25)14-17(2)33-26(31-12)27-36-22(7,8)23(9,10)37-27/h15-17H,13-14H2,1-12H3 |
| InChIKey | VSNMPOOKQDMLSH-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 99.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.05 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|