C14H22BN5O2 — CID 177148211
5-[2-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazol-1-yl]propan-2-yl]-1H-1,2,4-triazole (PubChem CID 177148211) has the molecular formula C14H22BN5O2 and a molecular weight of 303.18 g/mol. Its IUPAC name is 5-[2-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazol-1-yl]propan-2-yl]-1H-1,2,4-triazole.
| Compound Name | 5-[2-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazol-1-yl]propan-2-yl]-1H-1,2,4-triazole |
|---|---|
| PubChem CID | 177148211 |
| Molecular Formula | C14H22BN5O2 |
| Molecular Weight | 303.18 g/mol |
| Exact Mass | 303.19 |
| IUPAC Name | 5-[2-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazol-1-yl]propan-2-yl]-1H-1,2,4-triazole |
| SMILES | CC(C)(c1ncn[nH]1)n1cc(B2OC(C)(C)C(C)(C)O2)cn1 |
| InChI | InChI=1S/C14H22BN5O2/c1-12(2,11-16-9-17-19-11)20-8-10(7-18-20)15-21-13(3,4)14(5,6)22-15/h7-9H,1-6H3,(H,16,17,19) |
| InChIKey | DIGUPKBGGSEIFU-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 77.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.18 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|