C12H15BFN3O2 — CID 171921879
3-fluoro-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazolo[1,5-a]pyrimidine (PubChem CID 171921879) has the molecular formula C12H15BFN3O2 and a molecular weight of 263.08 g/mol. Its IUPAC name is 3-fluoro-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazolo[1,5-a]pyrimidine.
| Compound Name | 3-fluoro-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazolo[1,5-a]pyrimidine |
|---|---|
| PubChem CID | 171921879 |
| Molecular Formula | C12H15BFN3O2 |
| Molecular Weight | 263.08 g/mol |
| Exact Mass | 263.12 |
| IUPAC Name | 3-fluoro-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazolo[1,5-a]pyrimidine |
| SMILES | CC1(C)OB(c2cnc3c(F)cnn3c2)OC1(C)C |
| InChI | InChI=1S/C12H15BFN3O2/c1-11(2)12(3,4)19-13(18-11)8-5-15-10-9(14)6-16-17(10)7-8/h5-7H,1-4H3 |
| InChIKey | YWEIXHVOZJPSSA-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 48.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.08 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|