C21H29BN4O4 — CID 169087502
N-(4-hydroxy-1-bicyclo[2.2.2]octanyl)-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazolo[1,5-a]pyrimidine-3-carboxamide (PubChem CID 169087502) has the molecular formula C21H29BN4O4 and a molecular weight of 412.30 g/mol. Its IUPAC name is N-(4-hydroxy-1-bicyclo[2.2.2]octanyl)-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazolo[1,5-a]pyrimidine-3-carboxamide.
| Compound Name | N-(4-hydroxy-1-bicyclo[2.2.2]octanyl)-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazolo[1,5-a]pyrimidine-3-carboxamide |
|---|---|
| PubChem CID | 169087502 |
| Molecular Formula | C21H29BN4O4 |
| Molecular Weight | 412.30 g/mol |
| Exact Mass | 412.23 |
| IUPAC Name | N-(4-hydroxy-1-bicyclo[2.2.2]octanyl)-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazolo[1,5-a]pyrimidine-3-carboxamide |
| SMILES | CC1(C)OB(c2cnc3c(C(=O)NC45CCC(O)(CC4)CC5)cnn3c2)OC1(C)C |
| InChI | InChI=1S/C21H29BN4O4/c1-18(2)19(3,4)30-22(29-18)14-11-23-16-15(12-24-26(16)13-14)17(27)25-20-5-8-21(28,9-6-20)10-7-20/h11-13,28H,5-10H2,1-4H3,(H,25,27) |
| InChIKey | MFPKVTYFVMNYHS-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 97.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.30 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|