C12H17BN2O4 — CID 175100743
3-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazol-1-yl]prop-2-enoic acid (PubChem CID 175100743) has the molecular formula C12H17BN2O4 and a molecular weight of 264.09 g/mol. Its IUPAC name is 3-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazol-1-yl]prop-2-enoic acid.
| Compound Name | 3-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazol-1-yl]prop-2-enoic acid |
|---|---|
| PubChem CID | 175100743 |
| Molecular Formula | C12H17BN2O4 |
| Molecular Weight | 264.09 g/mol |
| Exact Mass | 264.13 |
| IUPAC Name | 3-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazol-1-yl]prop-2-enoic acid |
| SMILES | CC1(C)OB(c2cnn(C=CC(=O)O)c2)OC1(C)C |
| InChI | InChI=1S/C12H17BN2O4/c1-11(2)12(3,4)19-13(18-11)9-7-14-15(8-9)6-5-10(16)17/h5-8H,1-4H3,(H,16,17) |
| InChIKey | WBBSMYDZHTVHBG-UHFFFAOYSA-N |
| XLogP | 0.74 |
| TPSA | 73.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.09 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|