C13H22BN5O2 — CID 174066090
N'-methyl-2-methylimino-2-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazol-1-yl]ethanimidamide (PubChem CID 174066090) has the molecular formula C13H22BN5O2 and a molecular weight of 291.16 g/mol. Its IUPAC name is N'-methyl-2-methylimino-2-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazol-1-yl]ethanimidamide.
| Compound Name | N'-methyl-2-methylimino-2-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazol-1-yl]ethanimidamide |
|---|---|
| PubChem CID | 174066090 |
| Molecular Formula | C13H22BN5O2 |
| Molecular Weight | 291.16 g/mol |
| Exact Mass | 291.19 |
| IUPAC Name | N'-methyl-2-methylimino-2-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazol-1-yl]ethanimidamide |
| SMILES | C/N=C(N)/C(=N\C)n1cc(B2OC(C)(C)C(C)(C)O2)cn1 |
| InChI | InChI=1S/C13H22BN5O2/c1-12(2)13(3,4)21-14(20-12)9-7-18-19(8-9)11(17-6)10(15)16-5/h7-8H,1-6H3,(H2,15,16)/b17-11+ |
| InChIKey | FUZJFLGIEQIMPL-GZTJUZNOSA-N |
| XLogP | 0.05 |
| TPSA | 87.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.16 |
| LogP ≤ 5 | 0.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|