C13H21BClN5O2 — CID 174368601
(3E)-4-chloro-2-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazol-1-yl]buta-1,3-diene-1,1,4-triamine (PubChem CID 174368601) has the molecular formula C13H21BClN5O2 and a molecular weight of 325.61 g/mol. Its IUPAC name is (3E)-4-chloro-2-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazol-1-yl]buta-1,3-diene-1,1,4-triamine.
| Compound Name | (3E)-4-chloro-2-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazol-1-yl]buta-1,3-diene-1,1,4-triamine |
|---|---|
| PubChem CID | 174368601 |
| Molecular Formula | C13H21BClN5O2 |
| Molecular Weight | 325.61 g/mol |
| Exact Mass | 325.15 |
| IUPAC Name | (3E)-4-chloro-2-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazol-1-yl]buta-1,3-diene-1,1,4-triamine |
| SMILES | CC1(C)OB(c2cnn(C(/C=C(\N)Cl)=C(N)N)c2)OC1(C)C |
| InChI | InChI=1S/C13H21BClN5O2/c1-12(2)13(3,4)22-14(21-12)8-6-19-20(7-8)9(11(17)18)5-10(15)16/h5-7H,16-18H2,1-4H3/b10-5- |
| InChIKey | ZMEOWLAZZSPQTK-YHYXMXQVSA-N |
| XLogP | 0.26 |
| TPSA | 114.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.61 |
| LogP ≤ 5 | 0.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|