C15H25BN2O4 — CID 165111873
ethyl 3,3,3-trideuterio-2-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazol-1-yl]-2-(trideuteriomethyl)propanoate (PubChem CID 165111873) has the molecular formula C15H25BN2O4 and a molecular weight of 314.22 g/mol. Its IUPAC name is ethyl 3,3,3-trideuterio-2-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazol-1-yl]-2-(trideuteriomethyl)propanoate.
| Compound Name | ethyl 3,3,3-trideuterio-2-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazol-1-yl]-2-(trideuteriomethyl)propanoate |
|---|---|
| PubChem CID | 165111873 |
| Molecular Formula | C15H25BN2O4 |
| Molecular Weight | 314.22 g/mol |
| Exact Mass | 314.23 |
| IUPAC Name | ethyl 3,3,3-trideuterio-2-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazol-1-yl]-2-(trideuteriomethyl)propanoate |
| SMILES | [2H]C([2H])([2H])C(C(=O)OCC)(n1cc(B2OC(C)(C)C(C)(C)O2)cn1)C([2H])([2H])[2H] |
| InChI | InChI=1S/C15H25BN2O4/c1-8-20-12(19)13(2,3)18-10-11(9-17-18)16-21-14(4,5)15(6,7)22-16/h9-10H,8H2,1-7H3/i2D3,3D3 |
| InChIKey | FIXNVGDENQNXPD-XERRXZQWSA-N |
| XLogP | 1.48 |
| TPSA | 62.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.22 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|