C13H22BN2NaO3 — CID 175839339
sodium;hydride;3-methyl-1-(oxetan-3-yl)-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazole (PubChem CID 175839339) has the molecular formula C13H22BN2NaO3 and a molecular weight of 288.13 g/mol. Its IUPAC name is sodium;hydride;3-methyl-1-(oxetan-3-yl)-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazole.
| Compound Name | sodium;hydride;3-methyl-1-(oxetan-3-yl)-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazole |
|---|---|
| PubChem CID | 175839339 |
| Molecular Formula | C13H22BN2NaO3 |
| Molecular Weight | 288.13 g/mol |
| Exact Mass | 288.16 |
| IUPAC Name | sodium;hydride;3-methyl-1-(oxetan-3-yl)-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazole |
| SMILES | Cc1nn(C2COC2)cc1B1OC(C)(C)C(C)(C)O1.[H-].[Na+] |
| InChI | InChI=1S/C13H21BN2O3.Na.H/c1-9-11(6-16(15-9)10-7-17-8-10)14-18-12(2,3)13(4,5)19-14;;/h6,10H,7-8H2,1-5H3;;/q;+1;-1 |
| InChIKey | NYJUZMOGNGEIFQ-UHFFFAOYSA-N |
| XLogP | -1.82 |
| TPSA | 45.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.13 |
| LogP ≤ 5 | -1.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|